C29H36N4O4 — CID 18379250
N-[4-[1-(hydroxyamino)-1-oxopropan-2-yl]-1-propylpiperidin-4-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide (PubChem CID 18379250) has the molecular formula C29H36N4O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is N-[4-[1-(hydroxyamino)-1-oxopropan-2-yl]-1-propylpiperidin-4-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide.
| Compound Name | N-[4-[1-(hydroxyamino)-1-oxopropan-2-yl]-1-propylpiperidin-4-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 18379250 |
| Molecular Formula | C29H36N4O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | N-[4-[1-(hydroxyamino)-1-oxopropan-2-yl]-1-propylpiperidin-4-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
| SMILES | CCCN1CCC(NC(=O)c2ccc(OCc3cc(C)nc4ccccc34)cc2)(C(C)C(=O)NO)CC1 |
| InChI | InChI=1S/C29H36N4O4/c1-4-15-33-16-13-29(14-17-33,21(3)27(34)32-36)31-28(35)22-9-11-24(12-10-22)37-19-23-18-20(2)30-26-8-6-5-7-25(23)26/h5-12,18,21,36H,4,13-17,19H2,1-3H3,(H,31,35)(H,32,34) |
| InChIKey | ZGIMASWILLPDPS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|