C27H32N4O4 — CID 18379440
N-[4-[2-(hydroxyamino)-2-oxoethyl]-1,3-dimethylpiperidin-4-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide (PubChem CID 18379440) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[4-[2-(hydroxyamino)-2-oxoethyl]-1,3-dimethylpiperidin-4-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide.
| Compound Name | N-[4-[2-(hydroxyamino)-2-oxoethyl]-1,3-dimethylpiperidin-4-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 18379440 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | N-[4-[2-(hydroxyamino)-2-oxoethyl]-1,3-dimethylpiperidin-4-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
| SMILES | Cc1cc(COc2ccc(C(=O)NC3(CC(=O)NO)CCN(C)CC3C)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C27H32N4O4/c1-18-16-31(3)13-12-27(18,15-25(32)30-34)29-26(33)20-8-10-22(11-9-20)35-17-21-14-19(2)28-24-7-5-4-6-23(21)24/h4-11,14,18,34H,12-13,15-17H2,1-3H3,(H,29,33)(H,30,32) |
| InChIKey | LLSIXEJJVQOGCC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|