C35H34F6N4O8 — CID 18379225
N-[3-[2-(hydroxyamino)-2-oxoethyl]-1-phenylpiperidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 18379225) has the molecular formula C35H34F6N4O8 and a molecular weight of 752.67 g/mol. Its IUPAC name is N-[3-[2-(hydroxyamino)-2-oxoethyl]-1-phenylpiperidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[3-[2-(hydroxyamino)-2-oxoethyl]-1-phenylpiperidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 18379225 |
| Molecular Formula | C35H34F6N4O8 |
| Molecular Weight | 752.67 g/mol |
| Exact Mass | 752.23 |
| IUPAC Name | N-[3-[2-(hydroxyamino)-2-oxoethyl]-1-phenylpiperidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cc(COc2ccc(C(=O)NC3(CC(=O)NO)CCCN(c4ccccc4)C3)cc2)c2ccccc2n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H32N4O4.2C2HF3O2/c1-22-18-24(27-10-5-6-11-28(27)32-22)20-39-26-14-12-23(13-15-26)30(37)33-31(19-29(36)34-38)16-7-17-35(21-31)25-8-3-2-4-9-25;2*3-2(4,5)1(6)7/h2-6,8-15,18,38H,7,16-17,19-21H2,1H3,(H,33,37)(H,34,36);2*(H,6,7) |
| InChIKey | YRUAQKMDMXMCEC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 178.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.67 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|