C29H29F3N4O6 — CID 91604720
[[2-[1-acetyl-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidin-3-yl]acetyl]amino] 2,2,2-trifluoroacetate (PubChem CID 91604720) has the molecular formula C29H29F3N4O6 and a molecular weight of 586.57 g/mol. Its IUPAC name is [[2-[1-acetyl-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidin-3-yl]acetyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[2-[1-acetyl-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidin-3-yl]acetyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91604720 |
| Molecular Formula | C29H29F3N4O6 |
| Molecular Weight | 586.57 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | [[2-[1-acetyl-3-[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]piperidin-3-yl]acetyl]amino] 2,2,2-trifluoroacetate |
| SMILES | CC(=O)N1CCCC(CC(=O)NOC(=O)C(F)(F)F)(NC(=O)c2ccc(OCc3cc(C)nc4ccccc34)cc2)C1 |
| InChI | InChI=1S/C29H29F3N4O6/c1-18-14-21(23-6-3-4-7-24(23)33-18)16-41-22-10-8-20(9-11-22)26(39)34-28(12-5-13-36(17-28)19(2)37)15-25(38)35-42-27(40)29(30,31)32/h3-4,6-11,14H,5,12-13,15-17H2,1-2H3,(H,34,39)(H,35,38) |
| InChIKey | IJRGKASDVCWNSM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|