C27H29F3N4O8S — CID 18379181
N-[3-[2-(hydroxyamino)-2-oxoethyl]-1-methylsulfonylpyrrolidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 18379181) has the molecular formula C27H29F3N4O8S and a molecular weight of 626.61 g/mol. Its IUPAC name is N-[3-[2-(hydroxyamino)-2-oxoethyl]-1-methylsulfonylpyrrolidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[3-[2-(hydroxyamino)-2-oxoethyl]-1-methylsulfonylpyrrolidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18379181 |
| Molecular Formula | C27H29F3N4O8S |
| Molecular Weight | 626.61 g/mol |
| Exact Mass | 626.17 |
| IUPAC Name | N-[3-[2-(hydroxyamino)-2-oxoethyl]-1-methylsulfonylpyrrolidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(COc2ccc(C(=O)NC3(CC(=O)NO)CCN(S(C)(=O)=O)C3)cc2)c2ccccc2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H28N4O6S.C2HF3O2/c1-17-13-19(21-5-3-4-6-22(21)26-17)15-35-20-9-7-18(8-10-20)24(31)27-25(14-23(30)28-32)11-12-29(16-25)36(2,33)34;3-2(4,5)1(6)7/h3-10,13,32H,11-12,14-16H2,1-2H3,(H,27,31)(H,28,30);(H,6,7) |
| InChIKey | MBVGOZPJHBZQAZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 175.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.61 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|