C29H32F3N3O6 — CID 18379321
N-[1-[2-(hydroxyamino)-2-oxoethyl]cycloheptyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 18379321) has the molecular formula C29H32F3N3O6 and a molecular weight of 575.58 g/mol. Its IUPAC name is N-[1-[2-(hydroxyamino)-2-oxoethyl]cycloheptyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[1-[2-(hydroxyamino)-2-oxoethyl]cycloheptyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18379321 |
| Molecular Formula | C29H32F3N3O6 |
| Molecular Weight | 575.58 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | N-[1-[2-(hydroxyamino)-2-oxoethyl]cycloheptyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(COc2ccc(C(=O)NC3(CC(=O)NO)CCCCCC3)cc2)c2ccccc2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H31N3O4.C2HF3O2/c1-19-16-21(23-8-4-5-9-24(23)28-19)18-34-22-12-10-20(11-13-22)26(32)29-27(17-25(31)30-33)14-6-2-3-7-15-27;3-2(4,5)1(6)7/h4-5,8-13,16,33H,2-3,6-7,14-15,17-18H2,1H3,(H,29,32)(H,30,31);(H,6,7) |
| InChIKey | GSMSWTXXEPAGRM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|