C31H34FN5O5S — CID 75303849
2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]propanamide (PubChem CID 75303849) has the molecular formula C31H34FN5O5S and a molecular weight of 607.71 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]propanamide.
| Compound Name | 2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 75303849 |
| Molecular Formula | C31H34FN5O5S |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.23 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-N-hydroxy-3-[[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]propanamide |
| SMILES | Cc1cc(COc2ccc(S(=O)(=O)NCC(C(=O)NO)N3CCN(Cc4ccc(F)cc4)CC3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C31H34FN5O5S/c1-22-18-24(28-4-2-3-5-29(28)34-22)21-42-26-10-12-27(13-11-26)43(40,41)33-19-30(31(38)35-39)37-16-14-36(15-17-37)20-23-6-8-25(32)9-7-23/h2-13,18,30,33,39H,14-17,19-21H2,1H3,(H,35,38) |
| InChIKey | UWCNFKCKFSEPKW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|