C26H31N5O6S — CID 140587277
2-[(2R)-3-(hydroxyamino)-2-(4-methylsulfonylpiperazin-1-yl)-3-oxopropyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide (PubChem CID 140587277) has the molecular formula C26H31N5O6S and a molecular weight of 541.63 g/mol. Its IUPAC name is 2-[(2R)-3-(hydroxyamino)-2-(4-methylsulfonylpiperazin-1-yl)-3-oxopropyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide.
| Compound Name | 2-[(2R)-3-(hydroxyamino)-2-(4-methylsulfonylpiperazin-1-yl)-3-oxopropyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 140587277 |
| Molecular Formula | C26H31N5O6S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 2-[(2R)-3-(hydroxyamino)-2-(4-methylsulfonylpiperazin-1-yl)-3-oxopropyl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
| SMILES | Cc1cc(COc2ccc(C(N)=O)c(C[C@H](C(=O)NO)N3CCN(S(C)(=O)=O)CC3)c2)c2ccccc2n1 |
| InChI | InChI=1S/C26H31N5O6S/c1-17-13-19(21-5-3-4-6-23(21)28-17)16-37-20-7-8-22(25(27)32)18(14-20)15-24(26(33)29-34)30-9-11-31(12-10-30)38(2,35)36/h3-8,13-14,24,34H,9-12,15-16H2,1-2H3,(H2,27,32)(H,29,33)/t24-/m1/s1 |
| InChIKey | JYHMQMQYJHSMBQ-XMMPIXPASA-N |
| XLogP | 1.21 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|