C25H30N6O6S — CID 140587285
2-[(2S)-2-[4-(benzenesulfonyl)piperazin-1-yl]-3-(hydroxyamino)-3-oxopropyl]-4-[(5-methyl-1H-pyrazol-4-yl)methoxy]benzamide (PubChem CID 140587285) has the molecular formula C25H30N6O6S and a molecular weight of 542.62 g/mol. Its IUPAC name is 2-[(2S)-2-[4-(benzenesulfonyl)piperazin-1-yl]-3-(hydroxyamino)-3-oxopropyl]-4-[(5-methyl-1H-pyrazol-4-yl)methoxy]benzamide.
| Compound Name | 2-[(2S)-2-[4-(benzenesulfonyl)piperazin-1-yl]-3-(hydroxyamino)-3-oxopropyl]-4-[(5-methyl-1H-pyrazol-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 140587285 |
| Molecular Formula | C25H30N6O6S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 2-[(2S)-2-[4-(benzenesulfonyl)piperazin-1-yl]-3-(hydroxyamino)-3-oxopropyl]-4-[(5-methyl-1H-pyrazol-4-yl)methoxy]benzamide |
| SMILES | Cc1[nH]ncc1COc1ccc(C(N)=O)c(C[C@@H](C(=O)NO)N2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C25H30N6O6S/c1-17-19(15-27-28-17)16-37-20-7-8-22(24(26)32)18(13-20)14-23(25(33)29-34)30-9-11-31(12-10-30)38(35,36)21-5-3-2-4-6-21/h2-8,13,15,23,34H,9-12,14,16H2,1H3,(H2,26,32)(H,27,28)(H,29,33)/t23-/m0/s1 |
| InChIKey | MLXJCRFTZVONJK-QHCPKHFHSA-N |
| XLogP | 0.82 |
| TPSA | 170.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|