C16H23N3O4S — CID 70415758
2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl 3-aminobut-2-enoate (PubChem CID 70415758) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl 3-aminobut-2-enoate.
| Compound Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl 3-aminobut-2-enoate |
|---|---|
| PubChem CID | 70415758 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl 3-aminobut-2-enoate |
| SMILES | CC(N)=CC(=O)OCCN1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H23N3O4S/c1-14(17)13-16(20)23-12-11-18-7-9-19(10-8-18)24(21,22)15-5-3-2-4-6-15/h2-6,13H,7-12,17H2,1H3 |
| InChIKey | KHIVTIKTIPXSGB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|