C21H26N2O3S — CID 110398655
3-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-1-phenylpropan-1-one (PubChem CID 110398655) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 3-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-1-phenylpropan-1-one.
| Compound Name | 3-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 110398655 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-1-phenylpropan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CCC(=O)c3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C21H26N2O3S/c1-17-8-9-20(16-18(17)2)27(25,26)23-14-12-22(13-15-23)11-10-21(24)19-6-4-3-5-7-19/h3-9,16H,10-15H2,1-2H3 |
| InChIKey | DFBOXINQXQHWJL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |