C22H26N2O3S — CID 60529173
(Z)-1-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-3-phenylbut-2-en-1-one (PubChem CID 60529173) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is (Z)-1-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-3-phenylbut-2-en-1-one.
| Compound Name | (Z)-1-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-3-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 60529173 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (Z)-1-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-3-phenylbut-2-en-1-one |
| SMILES | C/C(=C/C(=O)N1CCN(S(=O)(=O)c2ccc(C)c(C)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O3S/c1-17-9-10-21(15-18(17)2)28(26,27)24-13-11-23(12-14-24)22(25)16-19(3)20-7-5-4-6-8-20/h4-10,15-16H,11-14H2,1-3H3/b19-16- |
| InChIKey | ODFZFNDGCLGFID-MNDPQUGUSA-N |
| XLogP | 3.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|