C16H22N2O3S — CID 51088984
(Z)-1-(4-methylsulfonyl-1,4-diazepan-1-yl)-3-phenylbut-2-en-1-one (PubChem CID 51088984) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is (Z)-1-(4-methylsulfonyl-1,4-diazepan-1-yl)-3-phenylbut-2-en-1-one.
| Compound Name | (Z)-1-(4-methylsulfonyl-1,4-diazepan-1-yl)-3-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 51088984 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (Z)-1-(4-methylsulfonyl-1,4-diazepan-1-yl)-3-phenylbut-2-en-1-one |
| SMILES | C/C(=C/C(=O)N1CCCN(S(C)(=O)=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O3S/c1-14(15-7-4-3-5-8-15)13-16(19)17-9-6-10-18(12-11-17)22(2,20)21/h3-5,7-8,13H,6,9-12H2,1-2H3/b14-13- |
| InChIKey | DMCUPZQDGGBYPZ-YPKPFQOOSA-N |
| XLogP | 1.58 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|