C15H19N5O3S — CID 43066521
(4-methylsulfonyl-1,4-diazepan-1-yl)-(1-phenyltriazol-4-yl)methanone (PubChem CID 43066521) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is (4-methylsulfonyl-1,4-diazepan-1-yl)-(1-phenyltriazol-4-yl)methanone.
| Compound Name | (4-methylsulfonyl-1,4-diazepan-1-yl)-(1-phenyltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 43066521 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (4-methylsulfonyl-1,4-diazepan-1-yl)-(1-phenyltriazol-4-yl)methanone |
| SMILES | CS(=O)(=O)N1CCCN(C(=O)c2cn(-c3ccccc3)nn2)CC1 |
| InChI | InChI=1S/C15H19N5O3S/c1-24(22,23)19-9-5-8-18(10-11-19)15(21)14-12-20(17-16-14)13-6-3-2-4-7-13/h2-4,6-7,12H,5,8-11H2,1H3 |
| InChIKey | FRYLKPADXHFUJW-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |