C13H16N6O3S — CID 28935289
(4-methylsulfonylpiperazin-1-yl)-[4-(tetrazol-1-yl)phenyl]methanone (PubChem CID 28935289) has the molecular formula C13H16N6O3S and a molecular weight of 336.38 g/mol. Its IUPAC name is (4-methylsulfonylpiperazin-1-yl)-[4-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | (4-methylsulfonylpiperazin-1-yl)-[4-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 28935289 |
| Molecular Formula | C13H16N6O3S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (4-methylsulfonylpiperazin-1-yl)-[4-(tetrazol-1-yl)phenyl]methanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)c2ccc(-n3cnnn3)cc2)CC1 |
| InChI | InChI=1S/C13H16N6O3S/c1-23(21,22)18-8-6-17(7-9-18)13(20)11-2-4-12(5-3-11)19-10-14-15-16-19/h2-5,10H,6-9H2,1H3 |
| InChIKey | FQADTOXJBHQUER-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |