C19H20N6O4S — CID 28934975
[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-[4-(tetrazol-1-yl)phenyl]methanone (PubChem CID 28934975) has the molecular formula C19H20N6O4S and a molecular weight of 428.47 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-[4-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | [4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-[4-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 28934975 |
| Molecular Formula | C19H20N6O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-[4-(tetrazol-1-yl)phenyl]methanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4cnnn4)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H20N6O4S/c1-29-17-6-8-18(9-7-17)30(27,28)24-12-10-23(11-13-24)19(26)15-2-4-16(5-3-15)25-14-20-21-22-25/h2-9,14H,10-13H2,1H3 |
| InChIKey | RQFFWHKYQFXSRL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 110.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |