C15H16N4O3 — CID 119113549
(3S)-1-(1-phenyltriazole-4-carbonyl)piperidine-3-carboxylic acid (PubChem CID 119113549) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is (3S)-1-(1-phenyltriazole-4-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(1-phenyltriazole-4-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119113549 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (3S)-1-(1-phenyltriazole-4-carbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(C(=O)c2cn(-c3ccccc3)nn2)C1 |
| InChI | InChI=1S/C15H16N4O3/c20-14(18-8-4-5-11(9-18)15(21)22)13-10-19(17-16-13)12-6-2-1-3-7-12/h1-3,6-7,10-11H,4-5,8-9H2,(H,21,22)/t11-/m0/s1 |
| InChIKey | GRLUZBMQEIHNAC-NSHDSACASA-N |
| XLogP | 1.20 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |