C15H14ClFN4O3 — CID 120514208
(3S)-1-[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]piperidine-3-carboxylic acid (PubChem CID 120514208) has the molecular formula C15H14ClFN4O3 and a molecular weight of 352.75 g/mol. Its IUPAC name is (3S)-1-[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120514208 |
| Molecular Formula | C15H14ClFN4O3 |
| Molecular Weight | 352.75 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | (3S)-1-[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(C(=O)c2cn(-c3cccc(Cl)c3F)nn2)C1 |
| InChI | InChI=1S/C15H14ClFN4O3/c16-10-4-1-5-12(13(10)17)21-8-11(18-19-21)14(22)20-6-2-3-9(7-20)15(23)24/h1,4-5,8-9H,2-3,6-7H2,(H,23,24)/t9-/m0/s1 |
| InChIKey | ODTAMYYFEOTRHK-VIFPVBQESA-N |
| XLogP | 2.00 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.75 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |