C14H13ClFN5O2 — CID 97337027
(2S)-1-[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]pyrrolidine-2-carboxamide (PubChem CID 97337027) has the molecular formula C14H13ClFN5O2 and a molecular weight of 337.74 g/mol. Its IUPAC name is (2S)-1-[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 97337027 |
| Molecular Formula | C14H13ClFN5O2 |
| Molecular Weight | 337.74 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (2S)-1-[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN1C(=O)c1cn(-c2cccc(Cl)c2F)nn1 |
| InChI | InChI=1S/C14H13ClFN5O2/c15-8-3-1-4-10(12(8)16)21-7-9(18-19-21)14(23)20-6-2-5-11(20)13(17)22/h1,3-4,7,11H,2,5-6H2,(H2,17,22)/t11-/m0/s1 |
| InChIKey | BNQVZUUOLQJONU-NSHDSACASA-N |
| XLogP | 1.15 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.74 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |