C16H17ClN4O3 — CID 75469060
1-[1-(2-chlorophenyl)-5-methyltriazole-4-carbonyl]piperidine-3-carboxylic acid (PubChem CID 75469060) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)-5-methyltriazole-4-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[1-(2-chlorophenyl)-5-methyltriazole-4-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 75469060 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 1-[1-(2-chlorophenyl)-5-methyltriazole-4-carbonyl]piperidine-3-carboxylic acid |
| SMILES | Cc1c(C(=O)N2CCCC(C(=O)O)C2)nnn1-c1ccccc1Cl |
| InChI | InChI=1S/C16H17ClN4O3/c1-10-14(15(22)20-8-4-5-11(9-20)16(23)24)18-19-21(10)13-7-3-2-6-12(13)17/h2-3,6-7,11H,4-5,8-9H2,1H3,(H,23,24) |
| InChIKey | KDOKQHQKMJUTSD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |