C18H21ClN4O3 — CID 129415250
3-[(3R)-1-[1-(2-chlorophenyl)-5-methyltriazole-4-carbonyl]piperidin-3-yl]propanoic acid (PubChem CID 129415250) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is 3-[(3R)-1-[1-(2-chlorophenyl)-5-methyltriazole-4-carbonyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R)-1-[1-(2-chlorophenyl)-5-methyltriazole-4-carbonyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 129415250 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 3-[(3R)-1-[1-(2-chlorophenyl)-5-methyltriazole-4-carbonyl]piperidin-3-yl]propanoic acid |
| SMILES | Cc1c(C(=O)N2CCC[C@H](CCC(=O)O)C2)nnn1-c1ccccc1Cl |
| InChI | InChI=1S/C18H21ClN4O3/c1-12-17(20-21-23(12)15-7-3-2-6-14(15)19)18(26)22-10-4-5-13(11-22)8-9-16(24)25/h2-3,6-7,13H,4-5,8-11H2,1H3,(H,24,25)/t13-/m1/s1 |
| InChIKey | KYXDZSJPVKYPSE-CYBMUJFWSA-N |
| XLogP | 2.95 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |