C15H15ClN4O3 — CID 122140680
(2R)-1-[1-(2-chlorophenyl)-5-methyltriazole-4-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 122140680) has the molecular formula C15H15ClN4O3 and a molecular weight of 334.76 g/mol. Its IUPAC name is (2R)-1-[1-(2-chlorophenyl)-5-methyltriazole-4-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[1-(2-chlorophenyl)-5-methyltriazole-4-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122140680 |
| Molecular Formula | C15H15ClN4O3 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (2R)-1-[1-(2-chlorophenyl)-5-methyltriazole-4-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1c(C(=O)N2CCC[C@@H]2C(=O)O)nnn1-c1ccccc1Cl |
| InChI | InChI=1S/C15H15ClN4O3/c1-9-13(14(21)19-8-4-7-12(19)15(22)23)17-18-20(9)11-6-3-2-5-10(11)16/h2-3,5-6,12H,4,7-8H2,1H3,(H,22,23)/t12-/m1/s1 |
| InChIKey | VOAZADVQCVUCGG-GFCCVEGCSA-N |
| XLogP | 1.92 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |