C16H16ClN3O3 — CID 86784862
(2R)-1-[1-(2-chlorophenyl)pyrazole-4-carbonyl]piperidine-2-carboxylic acid (PubChem CID 86784862) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is (2R)-1-[1-(2-chlorophenyl)pyrazole-4-carbonyl]piperidine-2-carboxylic acid.
| Compound Name | (2R)-1-[1-(2-chlorophenyl)pyrazole-4-carbonyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 86784862 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (2R)-1-[1-(2-chlorophenyl)pyrazole-4-carbonyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCCN1C(=O)c1cnn(-c2ccccc2Cl)c1 |
| InChI | InChI=1S/C16H16ClN3O3/c17-12-5-1-2-6-13(12)20-10-11(9-18-20)15(21)19-8-4-3-7-14(19)16(22)23/h1-2,5-6,9-10,14H,3-4,7-8H2,(H,22,23)/t14-/m1/s1 |
| InChIKey | UZOKZOHPBLSLDE-CQSZACIVSA-N |
| XLogP | 2.61 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |