C15H16ClN3O2 — CID 91782065
(2R)-1-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 91782065) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. Its IUPAC name is (2R)-1-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 91782065 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (2R)-1-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1Cc1cnn(-c2ccccc2Cl)c1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-12-4-1-2-5-13(12)19-10-11(8-17-19)9-18-7-3-6-14(18)15(20)21/h1-2,4-5,8,10,14H,3,6-7,9H2,(H,20,21)/t14-/m1/s1 |
| InChIKey | KIPMZKJUQRWSFD-CQSZACIVSA-N |
| XLogP | 2.57 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |