C16H22N2O — CID 23282646
(1-benzylpyrrolidin-2-yl)-pyrrolidin-1-ylmethanone (PubChem CID 23282646) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is (1-benzylpyrrolidin-2-yl)-pyrrolidin-1-ylmethanone.
| Compound Name | (1-benzylpyrrolidin-2-yl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 23282646 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (1-benzylpyrrolidin-2-yl)-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1CCCN1Cc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C16H22N2O/c19-16(17-10-4-5-11-17)15-9-6-12-18(15)13-14-7-2-1-3-8-14/h1-3,7-8,15H,4-6,9-13H2 |
| InChIKey | NHHBXBWPDNUGHX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |