C20H26N2O — CID 56873934
[(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(1-benzylpyrrolidin-2-yl)methanone (PubChem CID 56873934) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is [(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(1-benzylpyrrolidin-2-yl)methanone.
| Compound Name | [(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(1-benzylpyrrolidin-2-yl)methanone |
|---|---|
| PubChem CID | 56873934 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | [(3aS,7aR)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(1-benzylpyrrolidin-2-yl)methanone |
| SMILES | O=C(C1CCCN1Cc1ccccc1)N1C[C@H]2CC=CC[C@H]2C1 |
| InChI | InChI=1S/C20H26N2O/c23-20(22-14-17-9-4-5-10-18(17)15-22)19-11-6-12-21(19)13-16-7-2-1-3-8-16/h1-5,7-8,17-19H,6,9-15H2/t17-,18+,19? |
| InChIKey | KOSJKWCRSWMNLU-DFNIBXOVSA-N |
| XLogP | 3.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|