C19H29N3O — CID 119546904
(1-benzylpyrrolidin-2-yl)-[4-(methylaminomethyl)piperidin-1-yl]methanone (PubChem CID 119546904) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is (1-benzylpyrrolidin-2-yl)-[4-(methylaminomethyl)piperidin-1-yl]methanone.
| Compound Name | (1-benzylpyrrolidin-2-yl)-[4-(methylaminomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119546904 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | (1-benzylpyrrolidin-2-yl)-[4-(methylaminomethyl)piperidin-1-yl]methanone |
| SMILES | CNCC1CCN(C(=O)C2CCCN2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H29N3O/c1-20-14-16-9-12-21(13-10-16)19(23)18-8-5-11-22(18)15-17-6-3-2-4-7-17/h2-4,6-7,16,18,20H,5,8-15H2,1H3 |
| InChIKey | GYFCMPUHDNHJSF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |