C19H31Cl2N3O — CID 119398857
(1-benzylpyrrolidin-2-yl)-[3-(methylaminomethyl)piperidin-1-yl]methanone;dihydrochloride (PubChem CID 119398857) has the molecular formula C19H31Cl2N3O and a molecular weight of 388.38 g/mol. Its IUPAC name is (1-benzylpyrrolidin-2-yl)-[3-(methylaminomethyl)piperidin-1-yl]methanone;dihydrochloride.
| Compound Name | (1-benzylpyrrolidin-2-yl)-[3-(methylaminomethyl)piperidin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119398857 |
| Molecular Formula | C19H31Cl2N3O |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (1-benzylpyrrolidin-2-yl)-[3-(methylaminomethyl)piperidin-1-yl]methanone;dihydrochloride |
| SMILES | CNCC1CCCN(C(=O)C2CCCN2Cc2ccccc2)C1.Cl.Cl |
| InChI | InChI=1S/C19H29N3O.2ClH/c1-20-13-17-9-5-12-22(15-17)19(23)18-10-6-11-21(18)14-16-7-3-2-4-8-16;;/h2-4,7-8,17-18,20H,5-6,9-15H2,1H3;2*1H |
| InChIKey | QUMKYXBHDHIGLI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |