C14H14ClN3O2 — CID 124851906
(2R)-1-[[1-(3-chlorophenyl)pyrazol-4-yl]methyl]azetidine-2-carboxylic acid (PubChem CID 124851906) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is (2R)-1-[[1-(3-chlorophenyl)pyrazol-4-yl]methyl]azetidine-2-carboxylic acid.
| Compound Name | (2R)-1-[[1-(3-chlorophenyl)pyrazol-4-yl]methyl]azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 124851906 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | (2R)-1-[[1-(3-chlorophenyl)pyrazol-4-yl]methyl]azetidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCN1Cc1cnn(-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C14H14ClN3O2/c15-11-2-1-3-12(6-11)18-9-10(7-16-18)8-17-5-4-13(17)14(19)20/h1-3,6-7,9,13H,4-5,8H2,(H,19,20)/t13-/m1/s1 |
| InChIKey | TVFGCLZEVLLKBI-CYBMUJFWSA-N |
| XLogP | 2.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |