C20H25ClN4O — CID 134696694
(4S,9aR)-8-[[1-(3-chlorophenyl)pyrazol-4-yl]methyl]-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 134696694) has the molecular formula C20H25ClN4O and a molecular weight of 372.90 g/mol. Its IUPAC name is (4S,9aR)-8-[[1-(3-chlorophenyl)pyrazol-4-yl]methyl]-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (4S,9aR)-8-[[1-(3-chlorophenyl)pyrazol-4-yl]methyl]-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 134696694 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (4S,9aR)-8-[[1-(3-chlorophenyl)pyrazol-4-yl]methyl]-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | Clc1cccc(-n2cc(CN3CCN4[C@@H](COC[C@@H]4C4CC4)C3)cn2)c1 |
| InChI | InChI=1S/C20H25ClN4O/c21-17-2-1-3-18(8-17)25-11-15(9-22-25)10-23-6-7-24-19(12-23)13-26-14-20(24)16-4-5-16/h1-3,8-9,11,16,19-20H,4-7,10,12-14H2/t19-,20-/m1/s1 |
| InChIKey | XUCIOOMDKKMLQS-WOJBJXKFSA-N |
| XLogP | 2.82 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |