C24H23ClFN5O2 — CID 131925308
(7S,9aR)-7-[(4-chlorophenyl)methyl]-2-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 131925308) has the molecular formula C24H23ClFN5O2 and a molecular weight of 467.93 g/mol. Its IUPAC name is (7S,9aR)-7-[(4-chlorophenyl)methyl]-2-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-[(4-chlorophenyl)methyl]-2-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 131925308 |
| Molecular Formula | C24H23ClFN5O2 |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | (7S,9aR)-7-[(4-chlorophenyl)methyl]-2-[[1-(3-fluorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1N[C@@H](Cc2ccc(Cl)cc2)C(=O)N2CCN(Cc3cnn(-c4cccc(F)c4)c3)C[C@H]12 |
| InChI | InChI=1S/C24H23ClFN5O2/c25-18-6-4-16(5-7-18)10-21-24(33)30-9-8-29(15-22(30)23(32)28-21)13-17-12-27-31(14-17)20-3-1-2-19(26)11-20/h1-7,11-12,14,21-22H,8-10,13,15H2,(H,28,32)/t21-,22+/m0/s1 |
| InChIKey | OFFRYVFZAHWYKF-FCHUYYIVSA-N |
| XLogP | 2.42 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |