C21H26ClN5O2 — CID 126461069
(7R,9aR)-2-[[1-(3-chlorophenyl)pyrazol-4-yl]methyl]-7-(2-methylpropyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 126461069) has the molecular formula C21H26ClN5O2 and a molecular weight of 415.93 g/mol. Its IUPAC name is (7R,9aR)-2-[[1-(3-chlorophenyl)pyrazol-4-yl]methyl]-7-(2-methylpropyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7R,9aR)-2-[[1-(3-chlorophenyl)pyrazol-4-yl]methyl]-7-(2-methylpropyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 126461069 |
| Molecular Formula | C21H26ClN5O2 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (7R,9aR)-2-[[1-(3-chlorophenyl)pyrazol-4-yl]methyl]-7-(2-methylpropyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CC(C)C[C@H]1NC(=O)[C@H]2CN(Cc3cnn(-c4cccc(Cl)c4)c3)CCN2C1=O |
| InChI | InChI=1S/C21H26ClN5O2/c1-14(2)8-18-21(29)26-7-6-25(13-19(26)20(28)24-18)11-15-10-23-27(12-15)17-5-3-4-16(22)9-17/h3-5,9-10,12,14,18-19H,6-8,11,13H2,1-2H3,(H,24,28)/t18-,19-/m1/s1 |
| InChIKey | MJEBCFYYOCKCEU-RTBURBONSA-N |
| XLogP | 2.08 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |