C18H20ClN5O2 — CID 56856996
(7S,9aR)-2-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]-7-methyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56856996) has the molecular formula C18H20ClN5O2 and a molecular weight of 373.84 g/mol. Its IUPAC name is (7S,9aR)-2-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]-7-methyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-2-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]-7-methyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56856996 |
| Molecular Formula | C18H20ClN5O2 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (7S,9aR)-2-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]-7-methyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | C[C@@H]1NC(=O)[C@H]2CN(Cc3cnn(-c4ccccc4Cl)c3)CCN2C1=O |
| InChI | InChI=1S/C18H20ClN5O2/c1-12-18(26)23-7-6-22(11-16(23)17(25)21-12)9-13-8-20-24(10-13)15-5-3-2-4-14(15)19/h2-5,8,10,12,16H,6-7,9,11H2,1H3,(H,21,25)/t12-,16+/m0/s1 |
| InChIKey | YMNQCYBHEFLTJE-BLLLJJGKSA-N |
| XLogP | 1.06 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |