C25H26ClN5O2 — CID 56853964
(7S,9aR)-7-benzyl-2-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56853964) has the molecular formula C25H26ClN5O2 and a molecular weight of 463.97 g/mol. Its IUPAC name is (7S,9aR)-7-benzyl-2-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-benzyl-2-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56853964 |
| Molecular Formula | C25H26ClN5O2 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (7S,9aR)-7-benzyl-2-[[1-(2-chlorophenyl)pyrazol-4-yl]methyl]-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CN1C(=O)[C@H]2CN(Cc3cnn(-c4ccccc4Cl)c3)CCN2C(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C25H26ClN5O2/c1-28-22(13-18-7-3-2-4-8-18)25(33)30-12-11-29(17-23(30)24(28)32)15-19-14-27-31(16-19)21-10-6-5-9-20(21)26/h2-10,14,16,22-23H,11-13,15,17H2,1H3/t22-,23+/m0/s1 |
| InChIKey | HFOXDKZHWFDNOY-XZOQPEGZSA-N |
| XLogP | 2.62 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |