C18H23ClN2O3 — CID 134712616
(4S,9aR)-8-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 134712616) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is (4S,9aR)-8-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (4S,9aR)-8-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 134712616 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (4S,9aR)-8-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-4-cyclopropyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | Clc1cc2c(cc1CN1CCN3[C@@H](COC[C@@H]3C3CC3)C1)OCO2 |
| InChI | InChI=1S/C18H23ClN2O3/c19-15-6-18-17(23-11-24-18)5-13(15)7-20-3-4-21-14(8-20)9-22-10-16(21)12-1-2-12/h5-6,12,14,16H,1-4,7-11H2/t14-,16-/m1/s1 |
| InChIKey | BXTRGEXHUXPQCD-GDBMZVCRSA-N |
| XLogP | 2.36 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |