C12H15ClN2O2 — CID 23289937
1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]piperazine (PubChem CID 23289937) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]piperazine.
| Compound Name | 1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]piperazine |
|---|---|
| PubChem CID | 23289937 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]piperazine |
| SMILES | Clc1cc2c(cc1CN1CCNCC1)OCO2 |
| InChI | InChI=1S/C12H15ClN2O2/c13-10-6-12-11(16-8-17-12)5-9(10)7-15-3-1-14-2-4-15/h5-6,14H,1-4,7-8H2 |
| InChIKey | RGHWBNDQNGLQSU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |