C8H6BrClO2 — CID 19105299
5-(bromomethyl)-6-chloro-1,3-benzodioxole (PubChem CID 19105299) has the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. Its IUPAC name is 5-(bromomethyl)-6-chloro-1,3-benzodioxole.
| Compound Name | 5-(bromomethyl)-6-chloro-1,3-benzodioxole |
|---|---|
| PubChem CID | 19105299 |
| Molecular Formula | C8H6BrClO2 |
| Molecular Weight | 249.49 g/mol |
| Exact Mass | 247.92 |
| IUPAC Name | 5-(bromomethyl)-6-chloro-1,3-benzodioxole |
| SMILES | Clc1cc2c(cc1CBr)OCO2 |
| InChI | InChI=1S/C8H6BrClO2/c9-3-5-1-7-8(2-6(5)10)12-4-11-7/h1-2H,3-4H2 |
| InChIKey | CYVUVCLPZRJNRF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|