C13H12ClNO5 — CID 12811052
2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-4,4-dimethyl-1,2-oxazolidine-3,5-dione (PubChem CID 12811052) has the molecular formula C13H12ClNO5 and a molecular weight of 297.69 g/mol. Its IUPAC name is 2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-4,4-dimethyl-1,2-oxazolidine-3,5-dione.
| Compound Name | 2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-4,4-dimethyl-1,2-oxazolidine-3,5-dione |
|---|---|
| PubChem CID | 12811052 |
| Molecular Formula | C13H12ClNO5 |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-4,4-dimethyl-1,2-oxazolidine-3,5-dione |
| SMILES | CC1(C)C(=O)ON(Cc2cc3c(cc2Cl)OCO3)C1=O |
| InChI | InChI=1S/C13H12ClNO5/c1-13(2)11(16)15(20-12(13)17)5-7-3-9-10(4-8(7)14)19-6-18-9/h3-4H,5-6H2,1-2H3 |
| InChIKey | KBVLIWWHSXPQTN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|