C11H15ClO2 — CID 176955593
5-chloro-6-ethyl-1,3-benzodioxole;ethane (PubChem CID 176955593) has the molecular formula C11H15ClO2 and a molecular weight of 214.69 g/mol. Its IUPAC name is 5-chloro-6-ethyl-1,3-benzodioxole;ethane.
| Compound Name | 5-chloro-6-ethyl-1,3-benzodioxole;ethane |
|---|---|
| PubChem CID | 176955593 |
| Molecular Formula | C11H15ClO2 |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 5-chloro-6-ethyl-1,3-benzodioxole;ethane |
| SMILES | CC.CCc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C9H9ClO2.C2H6/c1-2-6-3-8-9(4-7(6)10)12-5-11-8;1-2/h3-4H,2,5H2,1H3;1-2H3 |
| InChIKey | RDZIFQAVONEBHD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |