C12H15ClN2O3 — CID 51928180
1-[(2R)-butan-2-yl]-3-(6-chloro-1,3-benzodioxol-5-yl)urea (PubChem CID 51928180) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-3-(6-chloro-1,3-benzodioxol-5-yl)urea.
| Compound Name | 1-[(2R)-butan-2-yl]-3-(6-chloro-1,3-benzodioxol-5-yl)urea |
|---|---|
| PubChem CID | 51928180 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-3-(6-chloro-1,3-benzodioxol-5-yl)urea |
| SMILES | CC[C@@H](C)NC(=O)Nc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C12H15ClN2O3/c1-3-7(2)14-12(16)15-9-5-11-10(4-8(9)13)17-6-18-11/h4-5,7H,3,6H2,1-2H3,(H2,14,15,16)/t7-/m1/s1 |
| InChIKey | YBOAWDANZSTOOT-SSDOTTSWSA-N |
| XLogP | 2.99 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |