C12H14ClNO3 — CID 60699580
N-(6-chloro-1,3-benzodioxol-5-yl)-2,2-dimethylpropanamide (PubChem CID 60699580) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzodioxol-5-yl)-2,2-dimethylpropanamide.
| Compound Name | N-(6-chloro-1,3-benzodioxol-5-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 60699580 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N-(6-chloro-1,3-benzodioxol-5-yl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C12H14ClNO3/c1-12(2,3)11(15)14-8-5-10-9(4-7(8)13)16-6-17-10/h4-5H,6H2,1-3H3,(H,14,15) |
| InChIKey | DDYKDKICUOGUJF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |