C14H9ClINO3 — CID 39728188
N-(6-chloro-1,3-benzodioxol-5-yl)-4-iodobenzamide (PubChem CID 39728188) has the molecular formula C14H9ClINO3 and a molecular weight of 401.59 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzodioxol-5-yl)-4-iodobenzamide.
| Compound Name | N-(6-chloro-1,3-benzodioxol-5-yl)-4-iodobenzamide |
|---|---|
| PubChem CID | 39728188 |
| Molecular Formula | C14H9ClINO3 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 400.93 |
| IUPAC Name | N-(6-chloro-1,3-benzodioxol-5-yl)-4-iodobenzamide |
| SMILES | O=C(Nc1cc2c(cc1Cl)OCO2)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H9ClINO3/c15-10-5-12-13(20-7-19-12)6-11(10)17-14(18)8-1-3-9(16)4-2-8/h1-6H,7H2,(H,17,18) |
| InChIKey | FCNBTXKJUNWIBM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|