C12H7Cl2N3O3 — CID 107260856
6-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyrazine-2-carboxamide (PubChem CID 107260856) has the molecular formula C12H7Cl2N3O3 and a molecular weight of 312.11 g/mol. Its IUPAC name is 6-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyrazine-2-carboxamide.
| Compound Name | 6-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107260856 |
| Molecular Formula | C12H7Cl2N3O3 |
| Molecular Weight | 312.11 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 6-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyrazine-2-carboxamide |
| SMILES | O=C(Nc1cc2c(cc1Cl)OCO2)c1cncc(Cl)n1 |
| InChI | InChI=1S/C12H7Cl2N3O3/c13-6-1-9-10(20-5-19-9)2-7(6)17-12(18)8-3-15-4-11(14)16-8/h1-4H,5H2,(H,17,18) |
| InChIKey | RSRRISVFMCHNDX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.11 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |