C14H11ClN2O3 — CID 18158591
N-(6-chloro-1,3-benzodioxol-5-yl)-6-methylpyridine-3-carboxamide (PubChem CID 18158591) has the molecular formula C14H11ClN2O3 and a molecular weight of 290.71 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzodioxol-5-yl)-6-methylpyridine-3-carboxamide.
| Compound Name | N-(6-chloro-1,3-benzodioxol-5-yl)-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 18158591 |
| Molecular Formula | C14H11ClN2O3 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | N-(6-chloro-1,3-benzodioxol-5-yl)-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cc3c(cc2Cl)OCO3)cn1 |
| InChI | InChI=1S/C14H11ClN2O3/c1-8-2-3-9(6-16-8)14(18)17-11-5-13-12(4-10(11)15)19-7-20-13/h2-6H,7H2,1H3,(H,17,18) |
| InChIKey | NCBAATMOELGDKW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |