C10H10ClNO5 — CID 79346610
2-hydroxyethyl N-(6-chloro-1,3-benzodioxol-5-yl)carbamate (PubChem CID 79346610) has the molecular formula C10H10ClNO5 and a molecular weight of 259.64 g/mol. Its IUPAC name is 2-hydroxyethyl N-(6-chloro-1,3-benzodioxol-5-yl)carbamate.
| Compound Name | 2-hydroxyethyl N-(6-chloro-1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 79346610 |
| Molecular Formula | C10H10ClNO5 |
| Molecular Weight | 259.64 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 2-hydroxyethyl N-(6-chloro-1,3-benzodioxol-5-yl)carbamate |
| SMILES | O=C(Nc1cc2c(cc1Cl)OCO2)OCCO |
| InChI | InChI=1S/C10H10ClNO5/c11-6-3-8-9(17-5-16-8)4-7(6)12-10(14)15-2-1-13/h3-4,13H,1-2,5H2,(H,12,14) |
| InChIKey | NUJYQLSRRDBENG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.64 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |