C12H15ClN2O3 — CID 80543534
4-amino-N-(6-chloro-1,3-benzodioxol-5-yl)-2-methylbutanamide (PubChem CID 80543534) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 4-amino-N-(6-chloro-1,3-benzodioxol-5-yl)-2-methylbutanamide.
| Compound Name | 4-amino-N-(6-chloro-1,3-benzodioxol-5-yl)-2-methylbutanamide |
|---|---|
| PubChem CID | 80543534 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 4-amino-N-(6-chloro-1,3-benzodioxol-5-yl)-2-methylbutanamide |
| SMILES | CC(CCN)C(=O)Nc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C12H15ClN2O3/c1-7(2-3-14)12(16)15-9-5-11-10(4-8(9)13)17-6-18-11/h4-5,7H,2-3,6,14H2,1H3,(H,15,16) |
| InChIKey | JFVUJVNACGNXLJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |