C9H11ClN2O5S — CID 79345913
2-hydroxyethyl N-(2-chloro-5-sulfamoylphenyl)carbamate (PubChem CID 79345913) has the molecular formula C9H11ClN2O5S and a molecular weight of 294.72 g/mol. Its IUPAC name is 2-hydroxyethyl N-(2-chloro-5-sulfamoylphenyl)carbamate.
| Compound Name | 2-hydroxyethyl N-(2-chloro-5-sulfamoylphenyl)carbamate |
|---|---|
| PubChem CID | 79345913 |
| Molecular Formula | C9H11ClN2O5S |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2-hydroxyethyl N-(2-chloro-5-sulfamoylphenyl)carbamate |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(NC(=O)OCCO)c1 |
| InChI | InChI=1S/C9H11ClN2O5S/c10-7-2-1-6(18(11,15)16)5-8(7)12-9(14)17-4-3-13/h1-2,5,13H,3-4H2,(H,12,14)(H2,11,15,16) |
| InChIKey | AJVXHTYAGGOBGF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |