C10H11ClN2O5S2 — CID 104569457
2-[2-(2-chloro-5-sulfamoylanilino)-2-oxoethyl]sulfanylacetic acid (PubChem CID 104569457) has the molecular formula C10H11ClN2O5S2 and a molecular weight of 338.79 g/mol. Its IUPAC name is 2-[2-(2-chloro-5-sulfamoylanilino)-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-(2-chloro-5-sulfamoylanilino)-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104569457 |
| Molecular Formula | C10H11ClN2O5S2 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 2-[2-(2-chloro-5-sulfamoylanilino)-2-oxoethyl]sulfanylacetic acid |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(NC(=O)CSCC(=O)O)c1 |
| InChI | InChI=1S/C10H11ClN2O5S2/c11-7-2-1-6(20(12,17)18)3-8(7)13-9(14)4-19-5-10(15)16/h1-3H,4-5H2,(H,13,14)(H,15,16)(H2,12,17,18) |
| InChIKey | BTEDCNZGUPXMTF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |