C11H14N2O6S2 — CID 115575110
2-[2-(2-methoxy-5-sulfamoylanilino)-2-oxoethyl]sulfanylacetic acid (PubChem CID 115575110) has the molecular formula C11H14N2O6S2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[2-(2-methoxy-5-sulfamoylanilino)-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-(2-methoxy-5-sulfamoylanilino)-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 115575110 |
| Molecular Formula | C11H14N2O6S2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-[2-(2-methoxy-5-sulfamoylanilino)-2-oxoethyl]sulfanylacetic acid |
| SMILES | COc1ccc(S(N)(=O)=O)cc1NC(=O)CSCC(=O)O |
| InChI | InChI=1S/C11H14N2O6S2/c1-19-9-3-2-7(21(12,17)18)4-8(9)13-10(14)5-20-6-11(15)16/h2-4H,5-6H2,1H3,(H,13,14)(H,15,16)(H2,12,17,18) |
| InChIKey | RMOQNOASSLJYAX-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |