C11H17N3O5S — CID 79473829
2-(2-aminoethoxy)-N-(2-methoxy-5-sulfamoylphenyl)acetamide (PubChem CID 79473829) has the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-(2-methoxy-5-sulfamoylphenyl)acetamide.
| Compound Name | 2-(2-aminoethoxy)-N-(2-methoxy-5-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 79473829 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-(2-aminoethoxy)-N-(2-methoxy-5-sulfamoylphenyl)acetamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1NC(=O)COCCN |
| InChI | InChI=1S/C11H17N3O5S/c1-18-10-3-2-8(20(13,16)17)6-9(10)14-11(15)7-19-5-4-12/h2-3,6H,4-5,7,12H2,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | OMHVMHCJZGEOHG-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|